C7H15NOS3 — CID 118066186
3-sulfanyl-N,N-bis(2-sulfanylethyl)propanamide (PubChem CID 118066186) has the molecular formula C7H15NOS3 and a molecular weight of 225.40 g/mol. Its IUPAC name is 3-sulfanyl-N,N-bis(2-sulfanylethyl)propanamide.
| Compound Name | 3-sulfanyl-N,N-bis(2-sulfanylethyl)propanamide |
|---|---|
| PubChem CID | 118066186 |
| Molecular Formula | C7H15NOS3 |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 3-sulfanyl-N,N-bis(2-sulfanylethyl)propanamide |
| SMILES | O=C(CCS)N(CCS)CCS |
| InChI | InChI=1S/C7H15NOS3/c9-7(1-4-10)8(2-5-11)3-6-12/h10-12H,1-6H2 |
| InChIKey | BPAIOMZOGSYESI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|