C20H22N4O7S2 — CID 102109710
2-methyl-N'-[4-[4-[(2-methylprop-2-enoylamino)sulfamoyl]phenoxy]phenyl]sulfonylprop-2-enehydrazide (PubChem CID 102109710) has the molecular formula C20H22N4O7S2 and a molecular weight of 494.55 g/mol. Its IUPAC name is 2-methyl-N'-[4-[4-[(2-methylprop-2-enoylamino)sulfamoyl]phenoxy]phenyl]sulfonylprop-2-enehydrazide.
| Compound Name | 2-methyl-N'-[4-[4-[(2-methylprop-2-enoylamino)sulfamoyl]phenoxy]phenyl]sulfonylprop-2-enehydrazide |
|---|---|
| PubChem CID | 102109710 |
| Molecular Formula | C20H22N4O7S2 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 2-methyl-N'-[4-[4-[(2-methylprop-2-enoylamino)sulfamoyl]phenoxy]phenyl]sulfonylprop-2-enehydrazide |
| SMILES | C=C(C)C(=O)NNS(=O)(=O)c1ccc(Oc2ccc(S(=O)(=O)NNC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C20H22N4O7S2/c1-13(2)19(25)21-23-32(27,28)17-9-5-15(6-10-17)31-16-7-11-18(12-8-16)33(29,30)24-22-20(26)14(3)4/h5-12,23-24H,1,3H2,2,4H3,(H,21,25)(H,22,26) |
| InChIKey | OCDFNLYZQJYVDW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|