C11H12FNO6S2 — CID 118011510
[4-(fluoromethylsulfonylsulfamoyl)phenyl] 2-methylprop-2-enoate (PubChem CID 118011510) has the molecular formula C11H12FNO6S2 and a molecular weight of 337.35 g/mol. Its IUPAC name is [4-(fluoromethylsulfonylsulfamoyl)phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-(fluoromethylsulfonylsulfamoyl)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118011510 |
| Molecular Formula | C11H12FNO6S2 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | [4-(fluoromethylsulfonylsulfamoyl)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(S(=O)(=O)NS(=O)(=O)CF)cc1 |
| InChI | InChI=1S/C11H12FNO6S2/c1-8(2)11(14)19-9-3-5-10(6-4-9)21(17,18)13-20(15,16)7-12/h3-6,13H,1,7H2,2H3 |
| InChIKey | QLQZJJPCKFKZDL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|