C17H16N2O6 — CID 102110596
(3S)-4-(2,4-dinitrophenyl)-3-(2-methoxyphenyl)butanal (PubChem CID 102110596) has the molecular formula C17H16N2O6 and a molecular weight of 344.32 g/mol. Its IUPAC name is (3S)-4-(2,4-dinitrophenyl)-3-(2-methoxyphenyl)butanal.
| Compound Name | (3S)-4-(2,4-dinitrophenyl)-3-(2-methoxyphenyl)butanal |
|---|---|
| PubChem CID | 102110596 |
| Molecular Formula | C17H16N2O6 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (3S)-4-(2,4-dinitrophenyl)-3-(2-methoxyphenyl)butanal |
| SMILES | COc1ccccc1[C@H](CC=O)Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16N2O6/c1-25-17-5-3-2-4-15(17)12(8-9-20)10-13-6-7-14(18(21)22)11-16(13)19(23)24/h2-7,9,11-12H,8,10H2,1H3/t12-/m1/s1 |
| InChIKey | KLNUFOIYRHZAAX-GFCCVEGCSA-N |
| XLogP | 3.43 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|