C25H29N5O5 — CID 102111416
methyl 1-(tert-butylamino)-4-(3-methoxypropyl)-2-(4-nitrophenyl)imidazo[1,2-a]benzimidazole-7-carboxylate (PubChem CID 102111416) has the molecular formula C25H29N5O5 and a molecular weight of 479.54 g/mol. Its IUPAC name is methyl 1-(tert-butylamino)-4-(3-methoxypropyl)-2-(4-nitrophenyl)imidazo[1,2-a]benzimidazole-7-carboxylate.
| Compound Name | methyl 1-(tert-butylamino)-4-(3-methoxypropyl)-2-(4-nitrophenyl)imidazo[1,2-a]benzimidazole-7-carboxylate |
|---|---|
| PubChem CID | 102111416 |
| Molecular Formula | C25H29N5O5 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | methyl 1-(tert-butylamino)-4-(3-methoxypropyl)-2-(4-nitrophenyl)imidazo[1,2-a]benzimidazole-7-carboxylate |
| SMILES | COCCCn1c2ccc(C(=O)OC)cc2n2c(NC(C)(C)C)c(-c3ccc([N+](=O)[O-])cc3)nc12 |
| InChI | InChI=1S/C25H29N5O5/c1-25(2,3)27-22-21(16-7-10-18(11-8-16)30(32)33)26-24-28(13-6-14-34-4)19-12-9-17(23(31)35-5)15-20(19)29(22)24/h7-12,15,27H,6,13-14H2,1-5H3 |
| InChIKey | WUBILYSVPLBUMQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|