C19H20N4O3 — CID 70291269
1-[3-(tert-butylamino)-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-6-yl]ethenol (PubChem CID 70291269) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 1-[3-(tert-butylamino)-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-6-yl]ethenol.
| Compound Name | 1-[3-(tert-butylamino)-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-6-yl]ethenol |
|---|---|
| PubChem CID | 70291269 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-[3-(tert-butylamino)-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-6-yl]ethenol |
| SMILES | C=C(O)c1ccc2nc(-c3ccc([N+](=O)[O-])cc3)c(NC(C)(C)C)n2c1 |
| InChI | InChI=1S/C19H20N4O3/c1-12(24)14-7-10-16-20-17(13-5-8-15(9-6-13)23(25)26)18(22(16)11-14)21-19(2,3)4/h5-11,21,24H,1H2,2-4H3 |
| InChIKey | CYQCWJOGCKOBQX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|