C29H38F6O10S4 — CID 102112545
3-[3,3,4,4,5,5-hexafluoro-2-[5-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfonyl]-2-methylthiophen-3-yl]cyclopenten-1-yl]-5-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfonyl]-2-methylthiophene (PubChem CID 102112545) has the molecular formula C29H38F6O10S4 and a molecular weight of 788.87 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-[5-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfonyl]-2-methylthiophen-3-yl]cyclopenten-1-yl]-5-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfonyl]-2-methylthiophene.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-[5-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfonyl]-2-methylthiophen-3-yl]cyclopenten-1-yl]-5-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfonyl]-2-methylthiophene |
|---|---|
| PubChem CID | 102112545 |
| Molecular Formula | C29H38F6O10S4 |
| Molecular Weight | 788.87 g/mol |
| Exact Mass | 788.13 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-[5-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfonyl]-2-methylthiophen-3-yl]cyclopenten-1-yl]-5-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfonyl]-2-methylthiophene |
| SMILES | COCCOCCOCCS(=O)(=O)c1cc(C2=C(c3cc(S(=O)(=O)CCOCCOCCOC)sc3C)C(F)(F)C(F)(F)C2(F)F)c(C)s1 |
| InChI | InChI=1S/C29H38F6O10S4/c1-19-21(17-23(46-19)48(36,37)15-13-44-11-9-42-7-5-40-3)25-26(28(32,33)29(34,35)27(25,30)31)22-18-24(47-20(22)2)49(38,39)16-14-45-12-10-43-8-6-41-4/h17-18H,5-16H2,1-4H3 |
| InChIKey | ITSGUJFSRRQWCA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.87 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|