C21H36O7Si — CID 102112824
diethyl 2-(2-cyclopropylideneethyl)-2-[(E)-3-triethoxysilylprop-2-enyl]propanedioate (PubChem CID 102112824) has the molecular formula C21H36O7Si and a molecular weight of 428.60 g/mol. Its IUPAC name is diethyl 2-(2-cyclopropylideneethyl)-2-[(E)-3-triethoxysilylprop-2-enyl]propanedioate.
| Compound Name | diethyl 2-(2-cyclopropylideneethyl)-2-[(E)-3-triethoxysilylprop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 102112824 |
| Molecular Formula | C21H36O7Si |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | diethyl 2-(2-cyclopropylideneethyl)-2-[(E)-3-triethoxysilylprop-2-enyl]propanedioate |
| SMILES | CCOC(=O)C(CC=C1CC1)(C/C=C/[Si](OCC)(OCC)OCC)C(=O)OCC |
| InChI | InChI=1S/C21H36O7Si/c1-6-24-19(22)21(20(23)25-7-2,16-14-18-12-13-18)15-11-17-29(26-8-3,27-9-4)28-10-5/h11,14,17H,6-10,12-13,15-16H2,1-5H3/b17-11+ |
| InChIKey | XADDVJMLJICKOC-GZTJUZNOSA-N |
| XLogP | 3.74 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|