C54H51BrO8 — CID 102113014
(2R,3R,4S)-2-[3,4-bis(phenylmethoxy)phenyl]-8-bromo-4-(2-ethoxyethoxy)-3,5,7-tris(phenylmethoxy)-3,4-dihydro-2H-chromene (PubChem CID 102113014) has the molecular formula C54H51BrO8 and a molecular weight of 907.90 g/mol. Its IUPAC name is (2R,3R,4S)-2-[3,4-bis(phenylmethoxy)phenyl]-8-bromo-4-(2-ethoxyethoxy)-3,5,7-tris(phenylmethoxy)-3,4-dihydro-2H-chromene.
| Compound Name | (2R,3R,4S)-2-[3,4-bis(phenylmethoxy)phenyl]-8-bromo-4-(2-ethoxyethoxy)-3,5,7-tris(phenylmethoxy)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 102113014 |
| Molecular Formula | C54H51BrO8 |
| Molecular Weight | 907.90 g/mol |
| Exact Mass | 906.28 |
| IUPAC Name | (2R,3R,4S)-2-[3,4-bis(phenylmethoxy)phenyl]-8-bromo-4-(2-ethoxyethoxy)-3,5,7-tris(phenylmethoxy)-3,4-dihydro-2H-chromene |
| SMILES | CCOCCO[C@H]1c2c(OCc3ccccc3)cc(OCc3ccccc3)c(Br)c2O[C@H](c2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C54H51BrO8/c1-2-56-30-31-57-53-49-47(60-36-41-22-12-5-13-23-41)33-48(61-37-42-24-14-6-15-25-42)50(55)52(49)63-51(54(53)62-38-43-26-16-7-17-27-43)44-28-29-45(58-34-39-18-8-3-9-19-39)46(32-44)59-35-40-20-10-4-11-21-40/h3-29,32-33,51,53-54H,2,30-31,34-38H2,1H3/t51-,53+,54+/m1/s1 |
| InChIKey | SXLGNXDFVUOULV-CVSPOACLSA-N |
| XLogP | 12.58 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.90 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|