C45H38O8 — CID 13259578
[(2R,3S)-2-[3,4-bis(phenylmethoxy)phenyl]-8-formyl-5,7-bis(phenylmethoxy)-3,4-dihydro-2H-chromen-3-yl] formate (PubChem CID 13259578) has the molecular formula C45H38O8 and a molecular weight of 706.79 g/mol. Its IUPAC name is [(2R,3S)-2-[3,4-bis(phenylmethoxy)phenyl]-8-formyl-5,7-bis(phenylmethoxy)-3,4-dihydro-2H-chromen-3-yl] formate.
| Compound Name | [(2R,3S)-2-[3,4-bis(phenylmethoxy)phenyl]-8-formyl-5,7-bis(phenylmethoxy)-3,4-dihydro-2H-chromen-3-yl] formate |
|---|---|
| PubChem CID | 13259578 |
| Molecular Formula | C45H38O8 |
| Molecular Weight | 706.79 g/mol |
| Exact Mass | 706.26 |
| IUPAC Name | [(2R,3S)-2-[3,4-bis(phenylmethoxy)phenyl]-8-formyl-5,7-bis(phenylmethoxy)-3,4-dihydro-2H-chromen-3-yl] formate |
| SMILES | O=CO[C@H]1Cc2c(OCc3ccccc3)cc(OCc3ccccc3)c(C=O)c2O[C@@H]1c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C45H38O8/c46-26-38-41(50-29-34-17-9-3-10-18-34)25-40(49-28-33-15-7-2-8-16-33)37-24-43(52-31-47)44(53-45(37)38)36-21-22-39(48-27-32-13-5-1-6-14-32)42(23-36)51-30-35-19-11-4-12-20-35/h1-23,25-26,31,43-44H,24,27-30H2/t43-,44+/m0/s1 |
| InChIKey | YMLZPNBORVUWFA-JCGOJSMZSA-N |
| XLogP | 9.03 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.79 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|