C30H20O4 — CID 102113461
(1R,2S,13R,14S)-heptacyclo[12.6.6.22,13.03,12.05,10.015,20.021,26]octacosa-3(12),4,6,8,10,15(20),16,18,21,23,25,27-dodecaene-7,17-dicarboxylic acid (PubChem CID 102113461) has the molecular formula C30H20O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is (1R,2S,13R,14S)-heptacyclo[12.6.6.22,13.03,12.05,10.015,20.021,26]octacosa-3(12),4,6,8,10,15(20),16,18,21,23,25,27-dodecaene-7,17-dicarboxylic acid.
| Compound Name | (1R,2S,13R,14S)-heptacyclo[12.6.6.22,13.03,12.05,10.015,20.021,26]octacosa-3(12),4,6,8,10,15(20),16,18,21,23,25,27-dodecaene-7,17-dicarboxylic acid |
|---|---|
| PubChem CID | 102113461 |
| Molecular Formula | C30H20O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | (1R,2S,13R,14S)-heptacyclo[12.6.6.22,13.03,12.05,10.015,20.021,26]octacosa-3(12),4,6,8,10,15(20),16,18,21,23,25,27-dodecaene-7,17-dicarboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)[C@@H]1c3ccccc3[C@H]2[C@@H]2C=C[C@H]1c1cc3ccc(C(=O)O)cc3cc12 |
| InChI | InChI=1S/C30H20O4/c31-29(32)16-6-5-15-12-24-22-10-9-21(25(24)14-18(15)11-16)27-19-3-1-2-4-20(19)28(22)26-13-17(30(33)34)7-8-23(26)27/h1-14,21-22,27-28H,(H,31,32)(H,33,34)/t21-,22+,27+,28-/m1/s1 |
| InChIKey | SBYHTVQXMITWQC-BYXJMBFLSA-N |
| XLogP | 6.26 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|