C12H9NO3 — CID 102113660
3'-methylidenespiro[1H-indole-3,5'-oxolane]-2,2'-dione (PubChem CID 102113660) has the molecular formula C12H9NO3 and a molecular weight of 215.21 g/mol. Its IUPAC name is 3'-methylidenespiro[1H-indole-3,5'-oxolane]-2,2'-dione.
| Compound Name | 3'-methylidenespiro[1H-indole-3,5'-oxolane]-2,2'-dione |
|---|---|
| PubChem CID | 102113660 |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 3'-methylidenespiro[1H-indole-3,5'-oxolane]-2,2'-dione |
| SMILES | C=C1CC2(OC1=O)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C12H9NO3/c1-7-6-12(16-10(7)14)8-4-2-3-5-9(8)13-11(12)15/h2-5H,1,6H2,(H,13,15) |
| InChIKey | VOQFEZBFAQEJMR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|