C28H30O4 — CID 102113893
[(1R)-1-(4-methoxyphenyl)pent-4-enyl] 3-(4-phenylmethoxyphenyl)propanoate (PubChem CID 102113893) has the molecular formula C28H30O4 and a molecular weight of 430.54 g/mol. Its IUPAC name is [(1R)-1-(4-methoxyphenyl)pent-4-enyl] 3-(4-phenylmethoxyphenyl)propanoate.
| Compound Name | [(1R)-1-(4-methoxyphenyl)pent-4-enyl] 3-(4-phenylmethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 102113893 |
| Molecular Formula | C28H30O4 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | [(1R)-1-(4-methoxyphenyl)pent-4-enyl] 3-(4-phenylmethoxyphenyl)propanoate |
| SMILES | C=CCC[C@@H](OC(=O)CCc1ccc(OCc2ccccc2)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H30O4/c1-3-4-10-27(24-14-18-25(30-2)19-15-24)32-28(29)20-13-22-11-16-26(17-12-22)31-21-23-8-6-5-7-9-23/h3,5-9,11-12,14-19,27H,1,4,10,13,20-21H2,2H3/t27-/m1/s1 |
| InChIKey | GTZXCAWXRYTTIO-HHHXNRCGSA-N |
| XLogP | 6.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|