C34H33NO3P+ — CID 102120560
[2,4-dimethoxy-N-[(4-methoxyphenyl)methyl]anilino]-triphenylphosphanium (PubChem CID 102120560) has the molecular formula C34H33NO3P+ and a molecular weight of 534.62 g/mol. Its IUPAC name is [2,4-dimethoxy-N-[(4-methoxyphenyl)methyl]anilino]-triphenylphosphanium.
| Compound Name | [2,4-dimethoxy-N-[(4-methoxyphenyl)methyl]anilino]-triphenylphosphanium |
|---|---|
| PubChem CID | 102120560 |
| Molecular Formula | C34H33NO3P+ |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | [2,4-dimethoxy-N-[(4-methoxyphenyl)methyl]anilino]-triphenylphosphanium |
| SMILES | COc1ccc(CN(c2ccc(OC)cc2OC)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H33NO3P/c1-36-28-21-19-27(20-22-28)26-35(33-24-23-29(37-2)25-34(33)38-3)39(30-13-7-4-8-14-30,31-15-9-5-10-16-31)32-17-11-6-12-18-32/h4-25H,26H2,1-3H3/q+1 |
| InChIKey | UNTDYWOGDZZUEQ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|