C15H24N+ — CID 102121857
5-but-3-enyl-1-hex-5-enyl-2,3-dihydropyridin-1-ium (PubChem CID 102121857) has the molecular formula C15H24N+ and a molecular weight of 218.36 g/mol. Its IUPAC name is 5-but-3-enyl-1-hex-5-enyl-2,3-dihydropyridin-1-ium.
| Compound Name | 5-but-3-enyl-1-hex-5-enyl-2,3-dihydropyridin-1-ium |
|---|---|
| PubChem CID | 102121857 |
| Molecular Formula | C15H24N+ |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | 5-but-3-enyl-1-hex-5-enyl-2,3-dihydropyridin-1-ium |
| SMILES | C=CCCCC[N+]1=CC(CCC=C)=CCC1 |
| InChI | InChI=1S/C15H24N/c1-3-5-7-8-12-16-13-9-11-15(14-16)10-6-4-2/h3-4,11,14H,1-2,5-10,12-13H2/q+1 |
| InChIKey | NPIUOKCMZNHCSQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|