C13H24N2O9 — CID 102122424
[(2S,3R,4R,5R)-5-(aminomethyl)-3,4-dihydroxypyrrolidin-2-yl]methyl (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxane-2-carboxylate (PubChem CID 102122424) has the molecular formula C13H24N2O9 and a molecular weight of 352.34 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-5-(aminomethyl)-3,4-dihydroxypyrrolidin-2-yl]methyl (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxane-2-carboxylate.
| Compound Name | [(2S,3R,4R,5R)-5-(aminomethyl)-3,4-dihydroxypyrrolidin-2-yl]methyl (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 102122424 |
| Molecular Formula | C13H24N2O9 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | [(2S,3R,4R,5R)-5-(aminomethyl)-3,4-dihydroxypyrrolidin-2-yl]methyl (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxane-2-carboxylate |
| SMILES | CO[C@H]1O[C@H](C(=O)OC[C@@H]2N[C@H](CN)[C@@H](O)[C@@H]2O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H24N2O9/c1-22-13-10(20)8(18)9(19)11(24-13)12(21)23-3-5-7(17)6(16)4(2-14)15-5/h4-11,13,15-20H,2-3,14H2,1H3/t4-,5+,6-,7-,8+,9+,10-,11+,13+/m1/s1 |
| InChIKey | JFSHLIBPJRHDFI-WGBLGUBYSA-N |
| XLogP | -5.00 |
| TPSA | 183.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | -5.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |