C9H10O4S2 — CID 102124261
(1'R,4'R)-1,3-dioxospiro[1,3-dithiolane-2,7'-2-oxabicyclo[2.2.2]oct-5-ene]-3'-one (PubChem CID 102124261) has the molecular formula C9H10O4S2 and a molecular weight of 246.31 g/mol. Its IUPAC name is (1'R,4'R)-1,3-dioxospiro[1,3-dithiolane-2,7'-2-oxabicyclo[2.2.2]oct-5-ene]-3'-one.
| Compound Name | (1'R,4'R)-1,3-dioxospiro[1,3-dithiolane-2,7'-2-oxabicyclo[2.2.2]oct-5-ene]-3'-one |
|---|---|
| PubChem CID | 102124261 |
| Molecular Formula | C9H10O4S2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | (1'R,4'R)-1,3-dioxospiro[1,3-dithiolane-2,7'-2-oxabicyclo[2.2.2]oct-5-ene]-3'-one |
| SMILES | O=C1O[C@@H]2C=C[C@H]1CC21S(=O)CCS1=O |
| InChI | InChI=1S/C9H10O4S2/c10-8-6-1-2-7(13-8)9(5-6)14(11)3-4-15(9)12/h1-2,6-7H,3-5H2/t6-,7+,9?,14?,15?/m0/s1 |
| InChIKey | CZKBLJRWMXUIPT-ZHZJDPQLSA-N |
| XLogP | -0.30 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|