C8H10O3S2 — CID 122405491
(1S,1'R,3R,4'R)-spiro[1,3-dithiolane-2,5'-7-oxabicyclo[2.2.1]hept-2-ene] 1,3-dioxide (PubChem CID 122405491) has the molecular formula C8H10O3S2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (1S,1'R,3R,4'R)-spiro[1,3-dithiolane-2,5'-7-oxabicyclo[2.2.1]hept-2-ene] 1,3-dioxide.
| Compound Name | (1S,1'R,3R,4'R)-spiro[1,3-dithiolane-2,5'-7-oxabicyclo[2.2.1]hept-2-ene] 1,3-dioxide |
|---|---|
| PubChem CID | 122405491 |
| Molecular Formula | C8H10O3S2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | (1S,1'R,3R,4'R)-spiro[1,3-dithiolane-2,5'-7-oxabicyclo[2.2.1]hept-2-ene] 1,3-dioxide |
| SMILES | O=[S@]1CC[S@](=O)C12C[C@@H]1C=C[C@H]2O1 |
| InChI | InChI=1S/C8H10O3S2/c9-12-3-4-13(10)8(12)5-6-1-2-7(8)11-6/h1-2,6-7H,3-5H2/t6-,7+,12-,13-/m0/s1 |
| InChIKey | GYQYIJWEWWZDTI-JVQMOBQVSA-N |
| XLogP | -0.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|