C12H10O3S2 — CID 122411370
(1R,1'S,3S,4'S)-spiro[1λ4,3λ4-benzodithiole-2,5'-7-oxabicyclo[2.2.1]hept-2-ene] 1,3-dioxide (PubChem CID 122411370) has the molecular formula C12H10O3S2 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1R,1'S,3S,4'S)-spiro[1λ4,3λ4-benzodithiole-2,5'-7-oxabicyclo[2.2.1]hept-2-ene] 1,3-dioxide.
| Compound Name | (1R,1'S,3S,4'S)-spiro[1λ4,3λ4-benzodithiole-2,5'-7-oxabicyclo[2.2.1]hept-2-ene] 1,3-dioxide |
|---|---|
| PubChem CID | 122411370 |
| Molecular Formula | C12H10O3S2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | (1R,1'S,3S,4'S)-spiro[1λ4,3λ4-benzodithiole-2,5'-7-oxabicyclo[2.2.1]hept-2-ene] 1,3-dioxide |
| SMILES | O=[S@@]1c2ccccc2[S@@](=O)C12C[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C12H10O3S2/c13-16-9-3-1-2-4-10(9)17(14)12(16)7-8-5-6-11(12)15-8/h1-6,8,11H,7H2/t8-,11+,16-,17-/m1/s1 |
| InChIKey | QVIBIOXYRSMVPR-XBCHJWBWSA-N |
| XLogP | 1.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|