C18H33NO5 — CID 102125383
1-[(3'aR,6'S,6'aR)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,4'-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole]-6'-yl]heptan-1-amine (PubChem CID 102125383) has the molecular formula C18H33NO5 and a molecular weight of 343.46 g/mol. Its IUPAC name is 1-[(3'aR,6'S,6'aR)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,4'-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole]-6'-yl]heptan-1-amine.
| Compound Name | 1-[(3'aR,6'S,6'aR)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,4'-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole]-6'-yl]heptan-1-amine |
|---|---|
| PubChem CID | 102125383 |
| Molecular Formula | C18H33NO5 |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | 1-[(3'aR,6'S,6'aR)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,4'-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole]-6'-yl]heptan-1-amine |
| SMILES | CCCCCCC(N)[C@@H]1OC2(COC(C)(C)O2)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C18H33NO5/c1-6-7-8-9-10-12(19)13-14-15(23-17(4,5)21-14)18(22-13)11-20-16(2,3)24-18/h12-15H,6-11,19H2,1-5H3/t12?,13-,14+,15+,18?/m0/s1 |
| InChIKey | DXLAHQKAFNKSMO-YUGHPYOKSA-N |
| XLogP | 2.68 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|