C21H20ClNO7S — CID 102129991
dimethyl (3R)-3-(4-chlorophenyl)-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2,2-dicarboxylate (PubChem CID 102129991) has the molecular formula C21H20ClNO7S and a molecular weight of 465.91 g/mol. Its IUPAC name is dimethyl (3R)-3-(4-chlorophenyl)-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2,2-dicarboxylate.
| Compound Name | dimethyl (3R)-3-(4-chlorophenyl)-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102129991 |
| Molecular Formula | C21H20ClNO7S |
| Molecular Weight | 465.91 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | dimethyl (3R)-3-(4-chlorophenyl)-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@@H](c2ccc(Cl)cc2)CC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H20ClNO7S/c1-13-4-10-16(11-5-13)31(27,28)23-18(24)12-17(14-6-8-15(22)9-7-14)21(23,19(25)29-2)20(26)30-3/h4-11,17H,12H2,1-3H3/t17-/m1/s1 |
| InChIKey | BZSBCPBSOFUVCE-QGZVFWFLSA-N |
| XLogP | 2.44 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.91 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|