C26H46O3Si — CID 102130933
(4aS,4bS,7S,8S,8aS,10aR)-4b,8,10a-trimethyl-7-tri(propan-2-yl)silyloxy-1,2,4,4a,5,6,7,8,8a,9-decahydrophenanthrene-3,10-dione (PubChem CID 102130933) has the molecular formula C26H46O3Si and a molecular weight of 434.74 g/mol. Its IUPAC name is (4aS,4bS,7S,8S,8aS,10aR)-4b,8,10a-trimethyl-7-tri(propan-2-yl)silyloxy-1,2,4,4a,5,6,7,8,8a,9-decahydrophenanthrene-3,10-dione.
| Compound Name | (4aS,4bS,7S,8S,8aS,10aR)-4b,8,10a-trimethyl-7-tri(propan-2-yl)silyloxy-1,2,4,4a,5,6,7,8,8a,9-decahydrophenanthrene-3,10-dione |
|---|---|
| PubChem CID | 102130933 |
| Molecular Formula | C26H46O3Si |
| Molecular Weight | 434.74 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | (4aS,4bS,7S,8S,8aS,10aR)-4b,8,10a-trimethyl-7-tri(propan-2-yl)silyloxy-1,2,4,4a,5,6,7,8,8a,9-decahydrophenanthrene-3,10-dione |
| SMILES | CC(C)[Si](O[C@H]1CC[C@@]2(C)[C@@H](CC(=O)[C@]3(C)CCC(=O)C[C@@H]23)[C@@H]1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H46O3Si/c1-16(2)30(17(3)4,18(5)6)29-22-11-13-25(8)21(19(22)7)15-24(28)26(9)12-10-20(27)14-23(25)26/h16-19,21-23H,10-15H2,1-9H3/t19-,21-,22-,23-,25-,26+/m0/s1 |
| InChIKey | FMIKSLCYJMXQPG-JNPMTXRSSA-N |
| XLogP | 6.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.74 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|