C24H42O2Si — CID 134959506
(6S)-3,7,7-trimethyl-8-tri(propan-2-yl)silyloxytetracyclo[4.4.2.01,6.03,11]dodecan-4-one (PubChem CID 134959506) has the molecular formula C24H42O2Si and a molecular weight of 390.68 g/mol. Its IUPAC name is (6S)-3,7,7-trimethyl-8-tri(propan-2-yl)silyloxytetracyclo[4.4.2.01,6.03,11]dodecan-4-one.
| Compound Name | (6S)-3,7,7-trimethyl-8-tri(propan-2-yl)silyloxytetracyclo[4.4.2.01,6.03,11]dodecan-4-one |
|---|---|
| PubChem CID | 134959506 |
| Molecular Formula | C24H42O2Si |
| Molecular Weight | 390.68 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | (6S)-3,7,7-trimethyl-8-tri(propan-2-yl)silyloxytetracyclo[4.4.2.01,6.03,11]dodecan-4-one |
| SMILES | CC(C)[Si](OC1CCC23CC4(C)C(=O)C[C@]2(CC43)C1(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H42O2Si/c1-15(2)27(16(3)4,17(5)6)26-20-10-11-23-14-22(9)18(23)12-24(23,13-19(22)25)21(20,7)8/h15-18,20H,10-14H2,1-9H3/t18?,20?,22?,23?,24-/m1/s1 |
| InChIKey | CRCPYWBQHSEPQZ-BZDRUPEQSA-N |
| XLogP | 6.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.68 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|