C18H38O2Si — CID 101396465
tri(propan-2-yl)-[(3R)-2,2,6,6-tetramethyloxan-3-yl]oxysilane (PubChem CID 101396465) has the molecular formula C18H38O2Si and a molecular weight of 314.59 g/mol. Its IUPAC name is tri(propan-2-yl)-[(3R)-2,2,6,6-tetramethyloxan-3-yl]oxysilane.
| Compound Name | tri(propan-2-yl)-[(3R)-2,2,6,6-tetramethyloxan-3-yl]oxysilane |
|---|---|
| PubChem CID | 101396465 |
| Molecular Formula | C18H38O2Si |
| Molecular Weight | 314.59 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | tri(propan-2-yl)-[(3R)-2,2,6,6-tetramethyloxan-3-yl]oxysilane |
| SMILES | CC(C)[Si](O[C@@H]1CCC(C)(C)OC1(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H38O2Si/c1-13(2)21(14(3)4,15(5)6)19-16-11-12-17(7,8)20-18(16,9)10/h13-16H,11-12H2,1-10H3/t16-/m1/s1 |
| InChIKey | ZBULPJXZIUYYRX-MRXNPFEDSA-N |
| XLogP | 5.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.59 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|