C29H56O4Si — CID 25018687
(1S,2S,5S,6E,8R,10R,12S)-2,8,12-trimethyl-5-propan-2-yl-10-tri(propan-2-yl)silyloxy-15-oxabicyclo[10.2.1]pentadec-6-ene-2,8-diol (PubChem CID 25018687) has the molecular formula C29H56O4Si and a molecular weight of 496.85 g/mol. Its IUPAC name is (1S,2S,5S,6E,8R,10R,12S)-2,8,12-trimethyl-5-propan-2-yl-10-tri(propan-2-yl)silyloxy-15-oxabicyclo[10.2.1]pentadec-6-ene-2,8-diol.
| Compound Name | (1S,2S,5S,6E,8R,10R,12S)-2,8,12-trimethyl-5-propan-2-yl-10-tri(propan-2-yl)silyloxy-15-oxabicyclo[10.2.1]pentadec-6-ene-2,8-diol |
|---|---|
| PubChem CID | 25018687 |
| Molecular Formula | C29H56O4Si |
| Molecular Weight | 496.85 g/mol |
| Exact Mass | 496.39 |
| IUPAC Name | (1S,2S,5S,6E,8R,10R,12S)-2,8,12-trimethyl-5-propan-2-yl-10-tri(propan-2-yl)silyloxy-15-oxabicyclo[10.2.1]pentadec-6-ene-2,8-diol |
| SMILES | CC(C)[C@H]1/C=C/[C@](C)(O)C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C[C@]2(C)CC[C@H](O2)[C@@](C)(O)CC1 |
| InChI | InChI=1S/C29H56O4Si/c1-20(2)24-12-15-27(9,30)18-25(33-34(21(3)4,22(5)6)23(7)8)19-28(10)16-14-26(32-28)29(11,31)17-13-24/h12,15,20-26,30-31H,13-14,16-19H2,1-11H3/b15-12+/t24-,25+,26-,27-,28-,29-/m0/s1 |
| InChIKey | PZKOODVWTSLJQO-KLXQVVLWSA-N |
| XLogP | 7.39 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.85 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|