C22H46O2Si — CID 101396464
[(2R,3R)-6,6-dimethyl-2-(4-methylpentyl)oxan-3-yl]oxy-tri(propan-2-yl)silane (PubChem CID 101396464) has the molecular formula C22H46O2Si and a molecular weight of 370.69 g/mol. Its IUPAC name is [(2R,3R)-6,6-dimethyl-2-(4-methylpentyl)oxan-3-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(2R,3R)-6,6-dimethyl-2-(4-methylpentyl)oxan-3-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101396464 |
| Molecular Formula | C22H46O2Si |
| Molecular Weight | 370.69 g/mol |
| Exact Mass | 370.33 |
| IUPAC Name | [(2R,3R)-6,6-dimethyl-2-(4-methylpentyl)oxan-3-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)CCC[C@H]1OC(C)(C)CC[C@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H46O2Si/c1-16(2)12-11-13-20-21(14-15-22(9,10)23-20)24-25(17(3)4,18(5)6)19(7)8/h16-21H,11-15H2,1-10H3/t20-,21-/m1/s1 |
| InChIKey | NJSNOJLVVIHSBY-NHCUHLMSSA-N |
| XLogP | 7.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.69 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|