C23H17BrN2OS — CID 102131299
2-[(E)-2-(7-bromo-10-ethylphenothiazin-3-yl)ethenyl]-1,3-benzoxazole (PubChem CID 102131299) has the molecular formula C23H17BrN2OS and a molecular weight of 449.37 g/mol. Its IUPAC name is 2-[(E)-2-(7-bromo-10-ethylphenothiazin-3-yl)ethenyl]-1,3-benzoxazole.
| Compound Name | 2-[(E)-2-(7-bromo-10-ethylphenothiazin-3-yl)ethenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 102131299 |
| Molecular Formula | C23H17BrN2OS |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | 2-[(E)-2-(7-bromo-10-ethylphenothiazin-3-yl)ethenyl]-1,3-benzoxazole |
| SMILES | CCN1c2ccc(Br)cc2Sc2cc(/C=C/c3nc4ccccc4o3)ccc21 |
| InChI | InChI=1S/C23H17BrN2OS/c1-2-26-18-10-7-15(8-12-23-25-17-5-3-4-6-20(17)27-23)13-21(18)28-22-14-16(24)9-11-19(22)26/h3-14H,2H2,1H3/b12-8+ |
| InChIKey | ZAZLOFOZVVEOBQ-XYOKQWHBSA-N |
| XLogP | 7.38 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |