C17H20O4 — CID 102131570
(2S,13R)-2,13-dimethoxy-3,12-dioxapentacyclo[12.2.1.04,16.05,10.011,15]heptadeca-5,7,9-triene (PubChem CID 102131570) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is (2S,13R)-2,13-dimethoxy-3,12-dioxapentacyclo[12.2.1.04,16.05,10.011,15]heptadeca-5,7,9-triene.
| Compound Name | (2S,13R)-2,13-dimethoxy-3,12-dioxapentacyclo[12.2.1.04,16.05,10.011,15]heptadeca-5,7,9-triene |
|---|---|
| PubChem CID | 102131570 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (2S,13R)-2,13-dimethoxy-3,12-dioxapentacyclo[12.2.1.04,16.05,10.011,15]heptadeca-5,7,9-triene |
| SMILES | CO[C@@H]1OC2c3ccccc3C3O[C@H](OC)C4CC1C2C34 |
| InChI | InChI=1S/C17H20O4/c1-18-16-10-7-11-13-12(10)14(20-16)8-5-3-4-6-9(8)15(13)21-17(11)19-2/h3-6,10-17H,7H2,1-2H3/t10?,11?,12?,13?,14?,15?,16-,17+ |
| InChIKey | RRCIDNOHGHLKGJ-SNZHHNEESA-N |
| XLogP | 2.66 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |