C16H17NO4S2 — CID 102133949
4-[bis(ethylsulfanyl)methylidene]-1-(4-methoxyphenyl)pyrrolidine-2,3,5-trione (PubChem CID 102133949) has the molecular formula C16H17NO4S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-[bis(ethylsulfanyl)methylidene]-1-(4-methoxyphenyl)pyrrolidine-2,3,5-trione.
| Compound Name | 4-[bis(ethylsulfanyl)methylidene]-1-(4-methoxyphenyl)pyrrolidine-2,3,5-trione |
|---|---|
| PubChem CID | 102133949 |
| Molecular Formula | C16H17NO4S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 4-[bis(ethylsulfanyl)methylidene]-1-(4-methoxyphenyl)pyrrolidine-2,3,5-trione |
| SMILES | CCSC(SCC)=C1C(=O)C(=O)N(c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C16H17NO4S2/c1-4-22-16(23-5-2)12-13(18)15(20)17(14(12)19)10-6-8-11(21-3)9-7-10/h6-9H,4-5H2,1-3H3 |
| InChIKey | FWBHEJGUUOOUPS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|