C17H19NO3S2 — CID 102049174
3-[bis(ethylsulfanyl)methylidene]-1-(4-methoxyphenyl)pyridine-2,4-dione (PubChem CID 102049174) has the molecular formula C17H19NO3S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 3-[bis(ethylsulfanyl)methylidene]-1-(4-methoxyphenyl)pyridine-2,4-dione.
| Compound Name | 3-[bis(ethylsulfanyl)methylidene]-1-(4-methoxyphenyl)pyridine-2,4-dione |
|---|---|
| PubChem CID | 102049174 |
| Molecular Formula | C17H19NO3S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 3-[bis(ethylsulfanyl)methylidene]-1-(4-methoxyphenyl)pyridine-2,4-dione |
| SMILES | CCSC(SCC)=C1C(=O)C=CN(c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C17H19NO3S2/c1-4-22-17(23-5-2)15-14(19)10-11-18(16(15)20)12-6-8-13(21-3)9-7-12/h6-11H,4-5H2,1-3H3 |
| InChIKey | PTWPGVWYTXMVNK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|