C34H32N2O3 — CID 102136704
2-benzyl-3-(4-methoxyphenyl)-2-[(3-methoxyphenyl)methyl]-N-quinolin-8-ylpropanamide (PubChem CID 102136704) has the molecular formula C34H32N2O3 and a molecular weight of 516.64 g/mol. Its IUPAC name is 2-benzyl-3-(4-methoxyphenyl)-2-[(3-methoxyphenyl)methyl]-N-quinolin-8-ylpropanamide.
| Compound Name | 2-benzyl-3-(4-methoxyphenyl)-2-[(3-methoxyphenyl)methyl]-N-quinolin-8-ylpropanamide |
|---|---|
| PubChem CID | 102136704 |
| Molecular Formula | C34H32N2O3 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 2-benzyl-3-(4-methoxyphenyl)-2-[(3-methoxyphenyl)methyl]-N-quinolin-8-ylpropanamide |
| SMILES | COc1ccc(CC(Cc2ccccc2)(Cc2cccc(OC)c2)C(=O)Nc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C34H32N2O3/c1-38-29-18-16-26(17-19-29)23-34(22-25-9-4-3-5-10-25,24-27-11-6-14-30(21-27)39-2)33(37)36-31-15-7-12-28-13-8-20-35-32(28)31/h3-21H,22-24H2,1-2H3,(H,36,37) |
| InChIKey | ZVMIYWGTTIYMKF-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |