C28H24N2O2 — CID 163216169
3-benzyl-5-(4-methoxyphenyl)-N-quinolin-8-ylpent-4-ynamide (PubChem CID 163216169) has the molecular formula C28H24N2O2 and a molecular weight of 420.51 g/mol. Its IUPAC name is 3-benzyl-5-(4-methoxyphenyl)-N-quinolin-8-ylpent-4-ynamide.
| Compound Name | 3-benzyl-5-(4-methoxyphenyl)-N-quinolin-8-ylpent-4-ynamide |
|---|---|
| PubChem CID | 163216169 |
| Molecular Formula | C28H24N2O2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 3-benzyl-5-(4-methoxyphenyl)-N-quinolin-8-ylpent-4-ynamide |
| SMILES | COc1ccc(C#CC(CC(=O)Nc2cccc3cccnc23)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H24N2O2/c1-32-25-16-14-21(15-17-25)12-13-23(19-22-7-3-2-4-8-22)20-27(31)30-26-11-5-9-24-10-6-18-29-28(24)26/h2-11,14-18,23H,19-20H2,1H3,(H,30,31) |
| InChIKey | ZKHHKRZOEBQTDB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|