C22H17NO5S — CID 102136846
ethyl 8-[2-(3-methyl-1,3-benzothiazol-2-ylidene)ethylidene]-2,7-dioxochromene-3-carboxylate (PubChem CID 102136846) has the molecular formula C22H17NO5S and a molecular weight of 407.45 g/mol. Its IUPAC name is ethyl 8-[2-(3-methyl-1,3-benzothiazol-2-ylidene)ethylidene]-2,7-dioxochromene-3-carboxylate.
| Compound Name | ethyl 8-[2-(3-methyl-1,3-benzothiazol-2-ylidene)ethylidene]-2,7-dioxochromene-3-carboxylate |
|---|---|
| PubChem CID | 102136846 |
| Molecular Formula | C22H17NO5S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | ethyl 8-[2-(3-methyl-1,3-benzothiazol-2-ylidene)ethylidene]-2,7-dioxochromene-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c(oc1=O)C(=CC=C1Sc3ccccc3N1C)C(=O)C=C2 |
| InChI | InChI=1S/C22H17NO5S/c1-3-27-21(25)15-12-13-8-10-17(24)14(20(13)28-22(15)26)9-11-19-23(2)16-6-4-5-7-18(16)29-19/h4-12H,3H2,1-2H3 |
| InChIKey | KAIANTAAPSZCSL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|