C25H23NO5 — CID 102495805
ethyl 2,7-dioxo-8-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]chromene-3-carboxylate (PubChem CID 102495805) has the molecular formula C25H23NO5 and a molecular weight of 417.46 g/mol. Its IUPAC name is ethyl 2,7-dioxo-8-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]chromene-3-carboxylate.
| Compound Name | ethyl 2,7-dioxo-8-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]chromene-3-carboxylate |
|---|---|
| PubChem CID | 102495805 |
| Molecular Formula | C25H23NO5 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | ethyl 2,7-dioxo-8-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]chromene-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c(oc1=O)C(=CC=C1N(C)c3ccccc3C1(C)C)C(=O)C=C2 |
| InChI | InChI=1S/C25H23NO5/c1-5-30-23(28)17-14-15-10-12-20(27)16(22(15)31-24(17)29)11-13-21-25(2,3)18-8-6-7-9-19(18)26(21)4/h6-14H,5H2,1-4H3 |
| InChIKey | PSVRLYRKFZXMKD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|