C26H29N3O3S — CID 23992935
ethyl 1-ethyl-2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanylbenzimidazole-5-carboxylate (PubChem CID 23992935) has the molecular formula C26H29N3O3S and a molecular weight of 463.60 g/mol. Its IUPAC name is ethyl 1-ethyl-2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanylbenzimidazole-5-carboxylate.
| Compound Name | ethyl 1-ethyl-2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 23992935 |
| Molecular Formula | C26H29N3O3S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | ethyl 1-ethyl-2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanylbenzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)nc(SCC(=O)C=C1N(C)c3ccccc3C1(C)C)n2CC |
| InChI | InChI=1S/C26H29N3O3S/c1-6-29-22-13-12-17(24(31)32-7-2)14-20(22)27-25(29)33-16-18(30)15-23-26(3,4)19-10-8-9-11-21(19)28(23)5/h8-15H,6-7,16H2,1-5H3 |
| InChIKey | JWNGOWYHCWGULZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|