C23H26FNO2 — CID 102137191
(3R,4R)-1-benzyl-3-[cyclohexyl(hydroxy)methyl]-3-fluoro-4-phenylazetidin-2-one (PubChem CID 102137191) has the molecular formula C23H26FNO2 and a molecular weight of 367.46 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-3-[cyclohexyl(hydroxy)methyl]-3-fluoro-4-phenylazetidin-2-one.
| Compound Name | (3R,4R)-1-benzyl-3-[cyclohexyl(hydroxy)methyl]-3-fluoro-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 102137191 |
| Molecular Formula | C23H26FNO2 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | (3R,4R)-1-benzyl-3-[cyclohexyl(hydroxy)methyl]-3-fluoro-4-phenylazetidin-2-one |
| SMILES | O=C1N(Cc2ccccc2)[C@H](c2ccccc2)[C@@]1(F)C(O)C1CCCCC1 |
| InChI | InChI=1S/C23H26FNO2/c24-23(21(26)19-14-8-3-9-15-19)20(18-12-6-2-7-13-18)25(22(23)27)16-17-10-4-1-5-11-17/h1-2,4-7,10-13,19-21,26H,3,8-9,14-16H2/t20-,21?,23-/m1/s1 |
| InChIKey | FZOZLSZJHMFKFU-RAMXQINQSA-N |
| XLogP | 4.42 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |