C22H26BrN3 — CID 102138472
3-(4-bromophenyl)-1-methyl-5-pentyl-6,7,8,9-tetrahydropyrazolo[5,4-c]isoquinoline (PubChem CID 102138472) has the molecular formula C22H26BrN3 and a molecular weight of 412.38 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-methyl-5-pentyl-6,7,8,9-tetrahydropyrazolo[5,4-c]isoquinoline.
| Compound Name | 3-(4-bromophenyl)-1-methyl-5-pentyl-6,7,8,9-tetrahydropyrazolo[5,4-c]isoquinoline |
|---|---|
| PubChem CID | 102138472 |
| Molecular Formula | C22H26BrN3 |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 3-(4-bromophenyl)-1-methyl-5-pentyl-6,7,8,9-tetrahydropyrazolo[5,4-c]isoquinoline |
| SMILES | CCCCCc1nc2c(c(C)nn2-c2ccc(Br)cc2)c2c1CCCC2 |
| InChI | InChI=1S/C22H26BrN3/c1-3-4-5-10-20-18-8-6-7-9-19(18)21-15(2)25-26(22(21)24-20)17-13-11-16(23)12-14-17/h11-14H,3-10H2,1-2H3 |
| InChIKey | SRERIYIENQIICY-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|