About (2-methylsulfanyl-1,4-diphenylpyrrol-3-yl)-phenylmethanone
(2-methylsulfanyl-1,4-diphenylpyrrol-3-yl)-phenylmethanone (PubChem CID 102140254) has the molecular formula C24H19NOS
and a molecular weight of 369.49 g/mol. Its IUPAC name is (2-methylsulfanyl-1,4-diphenylpyrrol-3-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (2-methylsulfanyl-1,4-diphenylpyrrol-3-yl)-phenylmethanone |
| PubChem CID | 102140254 |
| Molecular Formula | C24H19NOS |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (2-methylsulfanyl-1,4-diphenylpyrrol-3-yl)-phenylmethanone |
| SMILES | CSc1c(C(=O)c2ccccc2)c(-c2ccccc2)cn1-c1ccccc1 |
| InChI | InChI=1S/C24H19NOS/c1-27-24-22(23(26)19-13-7-3-8-14-19)21(18-11-5-2-6-12-18)17-25(24)20-15-9-4-10-16-20/h2-17H,1H3 |
| InChIKey | AIKKUSHGPDZPEA-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methylsulfanyl-1,4-diphenylpyrrol-3-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylsulfanyl-1,4-diphenylpyrrol-3-yl)-phenylmethanone?
The IUPAC name of (2-methylsulfanyl-1,4-diphenylpyrrol-3-yl)-phenylmethanone (CID 102140254) is (2-methylsulfanyl-1,4-diphenylpyrrol-3-yl)-phenylmethanone.
What is the SMILES notation for (2-methylsulfanyl-1,4-diphenylpyrrol-3-yl)-phenylmethanone?
The canonical SMILES for (2-methylsulfanyl-1,4-diphenylpyrrol-3-yl)-phenylmethanone is CSc1c(C(=O)c2ccccc2)c(-c2ccccc2)cn1-c1ccccc1.
What is the InChIKey of (2-methylsulfanyl-1,4-diphenylpyrrol-3-yl)-phenylmethanone?
The InChIKey is AIKKUSHGPDZPEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19NOS/c1-27-24-22(23(26)19-13-7-3-8-14-19)21(18-11-5-2-6-12-18)17-25(24)20-15-9-4-10-16-20/h2-17H,1H3.
What are the key properties of (2-methylsulfanyl-1,4-diphenylpyrrol-3-yl)-phenylmethanone?
(2-methylsulfanyl-1,4-diphenylpyrrol-3-yl)-phenylmethanone has a molecular weight of 369.49 g/mol, XLogP of 6.10, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylsulfanyl-1,4-diphenylpyrrol-3-yl)-phenylmethanone is sourced from PubChem (CID 102140254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).