C20H21NO5 — CID 102140388
ethyl (3R,6S,7aS)-6-(furan-3-ylmethyl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate (PubChem CID 102140388) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is ethyl (3R,6S,7aS)-6-(furan-3-ylmethyl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate.
| Compound Name | ethyl (3R,6S,7aS)-6-(furan-3-ylmethyl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 102140388 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | ethyl (3R,6S,7aS)-6-(furan-3-ylmethyl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Cc2ccoc2)C[C@H]2CO[C@H](c3ccccc3)N2C1=O |
| InChI | InChI=1S/C20H21NO5/c1-2-25-19(23)20(10-14-8-9-24-12-14)11-16-13-26-17(21(16)18(20)22)15-6-4-3-5-7-15/h3-9,12,16-17H,2,10-11,13H2,1H3/t16-,17+,20-/m0/s1 |
| InChIKey | YJMFNFAKAAXQML-QKLQHJQFSA-N |
| XLogP | 2.70 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|