C42H27NO3 — CID 102140400
(14S,15R,19S,20S)-17-(2-methylphenyl)-14,20-diphenyl-17-azaheptacyclo[10.9.2.114,20.05,22.08,23.013,21.015,19]tetracosa-1,3,5(22),6,8(23),9,11,13(21)-octaene-16,18,24-trione (PubChem CID 102140400) has the molecular formula C42H27NO3 and a molecular weight of 593.68 g/mol. Its IUPAC name is (14S,15R,19S,20S)-17-(2-methylphenyl)-14,20-diphenyl-17-azaheptacyclo[10.9.2.114,20.05,22.08,23.013,21.015,19]tetracosa-1,3,5(22),6,8(23),9,11,13(21)-octaene-16,18,24-trione.
| Compound Name | (14S,15R,19S,20S)-17-(2-methylphenyl)-14,20-diphenyl-17-azaheptacyclo[10.9.2.114,20.05,22.08,23.013,21.015,19]tetracosa-1,3,5(22),6,8(23),9,11,13(21)-octaene-16,18,24-trione |
|---|---|
| PubChem CID | 102140400 |
| Molecular Formula | C42H27NO3 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.20 |
| IUPAC Name | (14S,15R,19S,20S)-17-(2-methylphenyl)-14,20-diphenyl-17-azaheptacyclo[10.9.2.114,20.05,22.08,23.013,21.015,19]tetracosa-1,3,5(22),6,8(23),9,11,13(21)-octaene-16,18,24-trione |
| SMILES | Cc1ccccc1N1C(=O)[C@@H]2[C@H](C1=O)[C@@]1(c3ccccc3)C(=O)[C@@]2(c2ccccc2)c2c1c1cccc3ccc4cccc2c4c31 |
| InChI | InChI=1S/C42H27NO3/c1-24-12-8-9-21-31(24)43-38(44)36-37(39(43)45)42(28-17-6-3-7-18-28)35-30-20-11-14-26-23-22-25-13-10-19-29(32(25)33(26)30)34(35)41(36,40(42)46)27-15-4-2-5-16-27/h2-23,36-37H,1H3/t36-,37+,41-,42-/m0/s1 |
| InChIKey | KQJVBUICCMNCHV-FGDVEMDPSA-N |
| XLogP | 7.87 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|