C51H33NO4 — CID 139045220
(1S,16R,17R,21S)-1,16-diphenyl-19-[2-(4-phenylphenoxy)phenyl]-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20,22-trione (PubChem CID 139045220) has the molecular formula C51H33NO4 and a molecular weight of 723.83 g/mol. Its IUPAC name is (1S,16R,17R,21S)-1,16-diphenyl-19-[2-(4-phenylphenoxy)phenyl]-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20,22-trione.
| Compound Name | (1S,16R,17R,21S)-1,16-diphenyl-19-[2-(4-phenylphenoxy)phenyl]-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20,22-trione |
|---|---|
| PubChem CID | 139045220 |
| Molecular Formula | C51H33NO4 |
| Molecular Weight | 723.83 g/mol |
| Exact Mass | 723.24 |
| IUPAC Name | (1S,16R,17R,21S)-1,16-diphenyl-19-[2-(4-phenylphenoxy)phenyl]-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20,22-trione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1c1ccccc1Oc1ccc(-c3ccccc3)cc1)[C@@]1(c3ccccc3)C(=O)[C@]2(c2ccccc2)c2c1c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C51H33NO4/c53-47-45-46(48(54)52(47)41-26-14-15-27-42(41)56-36-30-28-33(29-31-36)32-16-4-1-5-17-32)51(35-20-8-3-9-21-35)44-40-25-13-11-23-38(40)37-22-10-12-24-39(37)43(44)50(45,49(51)55)34-18-6-2-7-19-34/h1-31,45-46H/t45-,46+,50+,51- |
| InChIKey | MXSDBEWRBJOKIO-KVEWVQAJSA-N |
| XLogP | 10.43 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.83 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|