C12H15N — CID 102142891
2-methyl-5-(4-methylphenyl)-3,4-dihydro-2H-pyrrole (PubChem CID 102142891) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-methyl-5-(4-methylphenyl)-3,4-dihydro-2H-pyrrole.
| Compound Name | 2-methyl-5-(4-methylphenyl)-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 102142891 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-methyl-5-(4-methylphenyl)-3,4-dihydro-2H-pyrrole |
| SMILES | Cc1ccc(C2=NC(C)CC2)cc1 |
| InChI | InChI=1S/C12H15N/c1-9-3-6-11(7-4-9)12-8-5-10(2)13-12/h3-4,6-7,10H,5,8H2,1-2H3 |
| InChIKey | LUFCUMSGEKLMEA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |