C27H25N2OPS — CID 102144687
1-[3-(2-diphenylphosphanylethylsulfanyl)phenyl]-3-phenylurea (PubChem CID 102144687) has the molecular formula C27H25N2OPS and a molecular weight of 456.55 g/mol. Its IUPAC name is 1-[3-(2-diphenylphosphanylethylsulfanyl)phenyl]-3-phenylurea.
| Compound Name | 1-[3-(2-diphenylphosphanylethylsulfanyl)phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 102144687 |
| Molecular Formula | C27H25N2OPS |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 1-[3-(2-diphenylphosphanylethylsulfanyl)phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1cccc(SCCP(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H25N2OPS/c30-27(28-22-11-4-1-5-12-22)29-23-13-10-18-26(21-23)32-20-19-31(24-14-6-2-7-15-24)25-16-8-3-9-17-25/h1-18,21H,19-20H2,(H2,28,29,30) |
| InChIKey | HYZOHPYDCTVOGM-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|