C47H41N3O2P2S2 — CID 102482937
2-N,6-N-bis[4-(2-diphenylphosphanylethylsulfanyl)phenyl]pyridine-2,6-dicarboxamide (PubChem CID 102482937) has the molecular formula C47H41N3O2P2S2 and a molecular weight of 805.95 g/mol. Its IUPAC name is 2-N,6-N-bis[4-(2-diphenylphosphanylethylsulfanyl)phenyl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[4-(2-diphenylphosphanylethylsulfanyl)phenyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 102482937 |
| Molecular Formula | C47H41N3O2P2S2 |
| Molecular Weight | 805.95 g/mol |
| Exact Mass | 805.21 |
| IUPAC Name | 2-N,6-N-bis[4-(2-diphenylphosphanylethylsulfanyl)phenyl]pyridine-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccc(SCCP(c2ccccc2)c2ccccc2)cc1)c1cccc(C(=O)Nc2ccc(SCCP(c3ccccc3)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C47H41N3O2P2S2/c51-46(48-36-24-28-42(29-25-36)55-34-32-53(38-14-5-1-6-15-38)39-16-7-2-8-17-39)44-22-13-23-45(50-44)47(52)49-37-26-30-43(31-27-37)56-35-33-54(40-18-9-3-10-19-40)41-20-11-4-12-21-41/h1-31H,32-35H2,(H,48,51)(H,49,52) |
| InChIKey | UBXRDCJOHJNTNP-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.95 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|