C17H19ClN2O7 — CID 102144840
5-(2-chlorophenyl)-N'-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]furan-2-carbohydrazide (PubChem CID 102144840) has the molecular formula C17H19ClN2O7 and a molecular weight of 398.80 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N'-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]furan-2-carbohydrazide.
| Compound Name | 5-(2-chlorophenyl)-N'-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 102144840 |
| Molecular Formula | C17H19ClN2O7 |
| Molecular Weight | 398.80 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 5-(2-chlorophenyl)-N'-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]furan-2-carbohydrazide |
| SMILES | O=C(NN[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C17H19ClN2O7/c18-9-4-2-1-3-8(9)10-5-6-11(26-10)16(25)19-20-17-15(24)14(23)13(22)12(7-21)27-17/h1-6,12-15,17,20-24H,7H2,(H,19,25)/t12-,13-,14+,15-,17-/m1/s1 |
| InChIKey | WPJOUXNJNKCJRO-OWVAZHOYSA-N |
| XLogP | -0.37 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.80 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|