C9H17NO5 — CID 102145500
N-[(3S,4S,5R,6S)-4,5,6,7-tetrahydroxyhept-1-en-3-yl]acetamide (PubChem CID 102145500) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is N-[(3S,4S,5R,6S)-4,5,6,7-tetrahydroxyhept-1-en-3-yl]acetamide.
| Compound Name | N-[(3S,4S,5R,6S)-4,5,6,7-tetrahydroxyhept-1-en-3-yl]acetamide |
|---|---|
| PubChem CID | 102145500 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | N-[(3S,4S,5R,6S)-4,5,6,7-tetrahydroxyhept-1-en-3-yl]acetamide |
| SMILES | C=C[C@H](NC(C)=O)[C@H](O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C9H17NO5/c1-3-6(10-5(2)12)8(14)9(15)7(13)4-11/h3,6-9,11,13-15H,1,4H2,2H3,(H,10,12)/t6-,7-,8-,9-/m0/s1 |
| InChIKey | DNERTMJRVCZTKV-JBDRJPRFSA-N |
| XLogP | -2.25 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|