C22H22O2 — CID 102147697
4-(4,4-dimethyl-5-phenacylcyclopenten-1-yl)benzaldehyde (PubChem CID 102147697) has the molecular formula C22H22O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-(4,4-dimethyl-5-phenacylcyclopenten-1-yl)benzaldehyde.
| Compound Name | 4-(4,4-dimethyl-5-phenacylcyclopenten-1-yl)benzaldehyde |
|---|---|
| PubChem CID | 102147697 |
| Molecular Formula | C22H22O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 4-(4,4-dimethyl-5-phenacylcyclopenten-1-yl)benzaldehyde |
| SMILES | CC1(C)CC=C(c2ccc(C=O)cc2)C1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H22O2/c1-22(2)13-12-19(17-10-8-16(15-23)9-11-17)20(22)14-21(24)18-6-4-3-5-7-18/h3-12,15,20H,13-14H2,1-2H3 |
| InChIKey | UKYQYBYZFKGFLL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|