C46H32F6N6O5 — CID 102150212
2-[4,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl]-3,4,5,6-tetrafluorobenzoic acid (PubChem CID 102150212) has the molecular formula C46H32F6N6O5 and a molecular weight of 862.79 g/mol. Its IUPAC name is 2-[4,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl]-3,4,5,6-tetrafluorobenzoic acid.
| Compound Name | 2-[4,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl]-3,4,5,6-tetrafluorobenzoic acid |
|---|---|
| PubChem CID | 102150212 |
| Molecular Formula | C46H32F6N6O5 |
| Molecular Weight | 862.79 g/mol |
| Exact Mass | 862.23 |
| IUPAC Name | 2-[4,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl]-3,4,5,6-tetrafluorobenzoic acid |
| SMILES | O=C(O)c1c(F)c(F)c(F)c(F)c1-c1c2cc(F)c(=O)c(CN(Cc3ccccn3)Cc3ccccn3)c-2oc2c(CN(Cc3ccccn3)Cc3ccccn3)c(O)c(F)cc12 |
| InChI | InChI=1S/C46H32F6N6O5/c47-33-17-29-35(36-37(46(61)62)39(50)41(52)40(51)38(36)49)30-18-34(48)43(60)32(24-58(21-27-11-3-7-15-55-27)22-28-12-4-8-16-56-28)45(30)63-44(29)31(42(33)59)23-57(19-25-9-1-5-13-53-25)20-26-10-2-6-14-54-26/h1-18,59H,19-24H2,(H,61,62) |
| InChIKey | KOWZKMJXYLURTL-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 145.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.79 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|