C33H34F3O8P — CID 102151601
dibenzyl [(2R,3S)-5,5,5-trifluoro-4,4-dihydroxy-2,3-bis(phenylmethoxy)pentyl] phosphate (PubChem CID 102151601) has the molecular formula C33H34F3O8P and a molecular weight of 646.60 g/mol. Its IUPAC name is dibenzyl [(2R,3S)-5,5,5-trifluoro-4,4-dihydroxy-2,3-bis(phenylmethoxy)pentyl] phosphate.
| Compound Name | dibenzyl [(2R,3S)-5,5,5-trifluoro-4,4-dihydroxy-2,3-bis(phenylmethoxy)pentyl] phosphate |
|---|---|
| PubChem CID | 102151601 |
| Molecular Formula | C33H34F3O8P |
| Molecular Weight | 646.60 g/mol |
| Exact Mass | 646.19 |
| IUPAC Name | dibenzyl [(2R,3S)-5,5,5-trifluoro-4,4-dihydroxy-2,3-bis(phenylmethoxy)pentyl] phosphate |
| SMILES | O=P(OCc1ccccc1)(OCc1ccccc1)OC[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)C(O)(O)C(F)(F)F |
| InChI | InChI=1S/C33H34F3O8P/c34-33(35,36)32(37,38)31(41-22-27-15-7-2-8-16-27)30(40-21-26-13-5-1-6-14-26)25-44-45(39,42-23-28-17-9-3-10-18-28)43-24-29-19-11-4-12-20-29/h1-20,30-31,37-38H,21-25H2/t30-,31+/m1/s1 |
| InChIKey | GBDFCATZYUTYRH-JSOSNVBQSA-N |
| XLogP | 6.96 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.60 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|