C7H10O2 — CID 102154260
(1R)-1-[(2R)-2,5-dihydrofuran-2-yl]prop-2-en-1-ol (PubChem CID 102154260) has the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. Its IUPAC name is (1R)-1-[(2R)-2,5-dihydrofuran-2-yl]prop-2-en-1-ol.
| Compound Name | (1R)-1-[(2R)-2,5-dihydrofuran-2-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 102154260 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | (1R)-1-[(2R)-2,5-dihydrofuran-2-yl]prop-2-en-1-ol |
| SMILES | C=C[C@@H](O)[C@H]1C=CCO1 |
| InChI | InChI=1S/C7H10O2/c1-2-6(8)7-4-3-5-9-7/h2-4,6-8H,1,5H2/t6-,7-/m1/s1 |
| InChIKey | LPJHOCKPZHVKLQ-RNFRBKRXSA-N |
| XLogP | 0.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|